C19H20Cl2N4O3S — CID 55335539
3-[2-[2-(3,4-dichlorophenyl)imino-1,3-thiazinan-3-yl]-2-oxoethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 55335539) has the molecular formula C19H20Cl2N4O3S and a molecular weight of 455.37 g/mol. Its IUPAC name is 3-[2-[2-(3,4-dichlorophenyl)imino-1,3-thiazinan-3-yl]-2-oxoethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[2-[2-(3,4-dichlorophenyl)imino-1,3-thiazinan-3-yl]-2-oxoethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 55335539 |
| Molecular Formula | C19H20Cl2N4O3S |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 3-[2-[2-(3,4-dichlorophenyl)imino-1,3-thiazinan-3-yl]-2-oxoethyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC2(CCCC2)C(=O)N1CC(=O)N1CCCS/C1=N\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H20Cl2N4O3S/c20-13-5-4-12(10-14(13)21)22-18-24(8-3-9-29-18)15(26)11-25-16(27)19(23-17(25)28)6-1-2-7-19/h4-5,10H,1-3,6-9,11H2,(H,23,28)/b22-18- |
| InChIKey | IQFZOJIUIMAHGG-PYCFMQQDSA-N |
| XLogP | 3.81 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|