C22H26Cl2N4O3S — CID 55433677
3-[3-[2-(3,4-dichlorophenyl)imino-4-ethyl-1,3-thiazolidin-3-yl]-3-oxopropyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 55433677) has the molecular formula C22H26Cl2N4O3S and a molecular weight of 497.45 g/mol. Its IUPAC name is 3-[3-[2-(3,4-dichlorophenyl)imino-4-ethyl-1,3-thiazolidin-3-yl]-3-oxopropyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[3-[2-(3,4-dichlorophenyl)imino-4-ethyl-1,3-thiazolidin-3-yl]-3-oxopropyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 55433677 |
| Molecular Formula | C22H26Cl2N4O3S |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 3-[3-[2-(3,4-dichlorophenyl)imino-4-ethyl-1,3-thiazolidin-3-yl]-3-oxopropyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CCC1CS/C(=N\c2ccc(Cl)c(Cl)c2)N1C(=O)CCN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C22H26Cl2N4O3S/c1-2-15-13-32-21(25-14-6-7-16(23)17(24)12-14)28(15)18(29)8-11-27-19(30)22(26-20(27)31)9-4-3-5-10-22/h6-7,12,15H,2-5,8-11,13H2,1H3,(H,26,31)/b25-21- |
| InChIKey | CONXXBJAMIZQIO-DAFNUICNSA-N |
| XLogP | 4.98 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|