C20H20N4O5S2 — CID 55336738
ethyl 2-[[5-[[2-(furan-2-carbonylamino)-3-phenylpropanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 55336738) has the molecular formula C20H20N4O5S2 and a molecular weight of 460.54 g/mol. Its IUPAC name is ethyl 2-[[5-[[2-(furan-2-carbonylamino)-3-phenylpropanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[2-(furan-2-carbonylamino)-3-phenylpropanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 55336738 |
| Molecular Formula | C20H20N4O5S2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | ethyl 2-[[5-[[2-(furan-2-carbonylamino)-3-phenylpropanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)C(Cc2ccccc2)NC(=O)c2ccco2)s1 |
| InChI | InChI=1S/C20H20N4O5S2/c1-2-28-16(25)12-30-20-24-23-19(31-20)22-17(26)14(11-13-7-4-3-5-8-13)21-18(27)15-9-6-10-29-15/h3-10,14H,2,11-12H2,1H3,(H,21,27)(H,22,23,26) |
| InChIKey | XIXBIPYZYWJITK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|