C21H28ClN5O3 — CID 55359695
N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 55359695) has the molecular formula C21H28ClN5O3 and a molecular weight of 433.94 g/mol. Its IUPAC name is N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 55359695 |
| Molecular Formula | C21H28ClN5O3 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | N-[5-chloro-2-(4-ethylpiperazin-1-yl)phenyl]-2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CCN1CCN(c2ccc(Cl)cc2NC(=O)CN2C(=O)NC(C)(C3CC3)C2=O)CC1 |
| InChI | InChI=1S/C21H28ClN5O3/c1-3-25-8-10-26(11-9-25)17-7-6-15(22)12-16(17)23-18(28)13-27-19(29)21(2,14-4-5-14)24-20(27)30/h6-7,12,14H,3-5,8-11,13H2,1-2H3,(H,23,28)(H,24,30) |
| InChIKey | INKKPIHYBINKSV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|