C21H25N3O3 — CID 55378756
[1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 3-indol-1-ylpropanoate (PubChem CID 55378756) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 3-indol-1-ylpropanoate.
| Compound Name | [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 3-indol-1-ylpropanoate |
|---|---|
| PubChem CID | 55378756 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 3-indol-1-ylpropanoate |
| SMILES | CC(OC(=O)CCn1ccc2ccccc21)C(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C21H25N3O3/c1-16(20(26)23-21(15-22)11-5-2-6-12-21)27-19(25)10-14-24-13-9-17-7-3-4-8-18(17)24/h3-4,7-9,13,16H,2,5-6,10-12,14H2,1H3,(H,23,26) |
| InChIKey | GIGMWBIPTBFIIR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |