C17H23N5O3 — CID 55999934
[1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 3-(pyrimidin-2-ylamino)propanoate (PubChem CID 55999934) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 3-(pyrimidin-2-ylamino)propanoate.
| Compound Name | [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 3-(pyrimidin-2-ylamino)propanoate |
|---|---|
| PubChem CID | 55999934 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 3-(pyrimidin-2-ylamino)propanoate |
| SMILES | CC(OC(=O)CCNc1ncccn1)C(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C17H23N5O3/c1-13(15(24)22-17(12-18)7-3-2-4-8-17)25-14(23)6-11-21-16-19-9-5-10-20-16/h5,9-10,13H,2-4,6-8,11H2,1H3,(H,22,24)(H,19,20,21) |
| InChIKey | MNPRPGWOCONURZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |