C15H18N4O3 — CID 7985731
[(2R)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] pyrazine-2-carboxylate (PubChem CID 7985731) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is [(2R)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] pyrazine-2-carboxylate.
| Compound Name | [(2R)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 7985731 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | [(2R)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] pyrazine-2-carboxylate |
| SMILES | C[C@@H](OC(=O)c1cnccn1)C(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C15H18N4O3/c1-11(22-14(21)12-9-17-7-8-18-12)13(20)19-15(10-16)5-3-2-4-6-15/h7-9,11H,2-6H2,1H3,(H,19,20)/t11-/m1/s1 |
| InChIKey | KQSNPGLMDPBNEX-LLVKDONJSA-N |
| XLogP | 1.36 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |