C24H26N2O5 — CID 55509116
[1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2-(4-phenoxyphenoxy)acetate (PubChem CID 55509116) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2-(4-phenoxyphenoxy)acetate.
| Compound Name | [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2-(4-phenoxyphenoxy)acetate |
|---|---|
| PubChem CID | 55509116 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2-(4-phenoxyphenoxy)acetate |
| SMILES | CC(OC(=O)COc1ccc(Oc2ccccc2)cc1)C(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C24H26N2O5/c1-18(23(28)26-24(17-25)14-6-3-7-15-24)30-22(27)16-29-19-10-12-21(13-11-19)31-20-8-4-2-5-9-20/h2,4-5,8-13,18H,3,6-7,14-16H2,1H3,(H,26,28) |
| InChIKey | HUIUWSCZFNLQCF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |