C21H21N3O4S3 — CID 55389172
4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitro-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 55389172) has the molecular formula C21H21N3O4S3 and a molecular weight of 475.62 g/mol. Its IUPAC name is 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitro-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitro-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55389172 |
| Molecular Formula | C21H21N3O4S3 |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitro-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | Cc1csc(Sc2ccc(C(=O)N(Cc3cccs3)CC3CCCO3)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C21H21N3O4S3/c1-14-13-30-21(22-14)31-19-7-6-15(10-18(19)24(26)27)20(25)23(11-16-4-2-8-28-16)12-17-5-3-9-29-17/h3,5-7,9-10,13,16H,2,4,8,11-12H2,1H3 |
| InChIKey | OULZIRCKSSTYPI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|