C24H35NO7S — CID 55420678
[1-[(1,1-dioxothiolan-3-yl)-ethylamino]-1-oxopropan-2-yl] 4-oxo-4-(4-pentoxyphenyl)butanoate (PubChem CID 55420678) has the molecular formula C24H35NO7S and a molecular weight of 481.61 g/mol. Its IUPAC name is [1-[(1,1-dioxothiolan-3-yl)-ethylamino]-1-oxopropan-2-yl] 4-oxo-4-(4-pentoxyphenyl)butanoate.
| Compound Name | [1-[(1,1-dioxothiolan-3-yl)-ethylamino]-1-oxopropan-2-yl] 4-oxo-4-(4-pentoxyphenyl)butanoate |
|---|---|
| PubChem CID | 55420678 |
| Molecular Formula | C24H35NO7S |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | [1-[(1,1-dioxothiolan-3-yl)-ethylamino]-1-oxopropan-2-yl] 4-oxo-4-(4-pentoxyphenyl)butanoate |
| SMILES | CCCCCOc1ccc(C(=O)CCC(=O)OC(C)C(=O)N(CC)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C24H35NO7S/c1-4-6-7-15-31-21-10-8-19(9-11-21)22(26)12-13-23(27)32-18(3)24(28)25(5-2)20-14-16-33(29,30)17-20/h8-11,18,20H,4-7,12-17H2,1-3H3 |
| InChIKey | UMSVJUFQPKPLAU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|