C21H30N4O5S — CID 55434166
2-[[2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl]-methylamino]-N-(3-methoxypropyl)acetamide (PubChem CID 55434166) has the molecular formula C21H30N4O5S and a molecular weight of 450.56 g/mol. Its IUPAC name is 2-[[2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl]-methylamino]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[[2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl]-methylamino]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 55434166 |
| Molecular Formula | C21H30N4O5S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 2-[[2-[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]-2-oxoethyl]-methylamino]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN(C)CC(=O)c1cc(C)n(-c2ccc(S(N)(=O)=O)cc2)c1C |
| InChI | InChI=1S/C21H30N4O5S/c1-15-12-19(20(26)13-24(3)14-21(27)23-10-5-11-30-4)16(2)25(15)17-6-8-18(9-7-17)31(22,28)29/h6-9,12H,5,10-11,13-14H2,1-4H3,(H,23,27)(H2,22,28,29) |
| InChIKey | URJPTYJGISWEEN-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|