C15H21BrN2O3S2 — CID 55452932
2-(4-bromo-2-methylphenyl)sulfanyl-N-(1,1-dioxothiolan-3-yl)-N',N'-dimethylacetohydrazide (PubChem CID 55452932) has the molecular formula C15H21BrN2O3S2 and a molecular weight of 421.38 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenyl)sulfanyl-N-(1,1-dioxothiolan-3-yl)-N',N'-dimethylacetohydrazide.
| Compound Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N-(1,1-dioxothiolan-3-yl)-N',N'-dimethylacetohydrazide |
|---|---|
| PubChem CID | 55452932 |
| Molecular Formula | C15H21BrN2O3S2 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N-(1,1-dioxothiolan-3-yl)-N',N'-dimethylacetohydrazide |
| SMILES | Cc1cc(Br)ccc1SCC(=O)N(C1CCS(=O)(=O)C1)N(C)C |
| InChI | InChI=1S/C15H21BrN2O3S2/c1-11-8-12(16)4-5-14(11)22-9-15(19)18(17(2)3)13-6-7-23(20,21)10-13/h4-5,8,13H,6-7,9-10H2,1-3H3 |
| InChIKey | MCFYLCFMSSVKEG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|