C17H26N2O5S2 — CID 55453153
[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 4-ethyl-5-propylthiophene-2-carboxylate (PubChem CID 55453153) has the molecular formula C17H26N2O5S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 4-ethyl-5-propylthiophene-2-carboxylate.
| Compound Name | [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 4-ethyl-5-propylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 55453153 |
| Molecular Formula | C17H26N2O5S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 4-ethyl-5-propylthiophene-2-carboxylate |
| SMILES | CCCc1sc(C(=O)OCC(=O)N2CCN(S(C)(=O)=O)CC2)cc1CC |
| InChI | InChI=1S/C17H26N2O5S2/c1-4-6-14-13(5-2)11-15(25-14)17(21)24-12-16(20)18-7-9-19(10-8-18)26(3,22)23/h11H,4-10,12H2,1-3H3 |
| InChIKey | ZHBGHYCZDHSOFO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |