C22H31N5O6S — CID 55456770
N-[2-[2-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]hydrazinyl]-2-oxoethyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 55456770) has the molecular formula C22H31N5O6S and a molecular weight of 493.59 g/mol. Its IUPAC name is N-[2-[2-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]hydrazinyl]-2-oxoethyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[2-[2-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]hydrazinyl]-2-oxoethyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 55456770 |
| Molecular Formula | C22H31N5O6S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | N-[2-[2-[2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]hydrazinyl]-2-oxoethyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)NNC(=O)CN(C)S(=O)(=O)c1ccc(C)cc1)C2=O |
| InChI | InChI=1S/C22H31N5O6S/c1-4-16-9-11-22(12-10-16)20(30)27(21(31)23-22)14-19(29)25-24-18(28)13-26(3)34(32,33)17-7-5-15(2)6-8-17/h5-8,16H,4,9-14H2,1-3H3,(H,23,31)(H,24,28)(H,25,29) |
| InChIKey | XMUZXXCWGSSJSU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|