C15H17BrN2O5S — CID 55459706
(3-bromo-4-methoxyphenyl)methyl 1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxylate (PubChem CID 55459706) has the molecular formula C15H17BrN2O5S and a molecular weight of 417.28 g/mol. Its IUPAC name is (3-bromo-4-methoxyphenyl)methyl 1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxylate.
| Compound Name | (3-bromo-4-methoxyphenyl)methyl 1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 55459706 |
| Molecular Formula | C15H17BrN2O5S |
| Molecular Weight | 417.28 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | (3-bromo-4-methoxyphenyl)methyl 1-methyl-4-(methylsulfamoyl)pyrrole-2-carboxylate |
| SMILES | CNS(=O)(=O)c1cc(C(=O)OCc2ccc(OC)c(Br)c2)n(C)c1 |
| InChI | InChI=1S/C15H17BrN2O5S/c1-17-24(20,21)11-7-13(18(2)8-11)15(19)23-9-10-4-5-14(22-3)12(16)6-10/h4-8,17H,9H2,1-3H3 |
| InChIKey | HLISEBQLPOLRGR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |