C17H13Cl3N2O5S — CID 55463488
[1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 5-methylsulfanyl-2-nitrobenzoate (PubChem CID 55463488) has the molecular formula C17H13Cl3N2O5S and a molecular weight of 463.73 g/mol. Its IUPAC name is [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 5-methylsulfanyl-2-nitrobenzoate.
| Compound Name | [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 5-methylsulfanyl-2-nitrobenzoate |
|---|---|
| PubChem CID | 55463488 |
| Molecular Formula | C17H13Cl3N2O5S |
| Molecular Weight | 463.73 g/mol |
| Exact Mass | 461.96 |
| IUPAC Name | [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 5-methylsulfanyl-2-nitrobenzoate |
| SMILES | CSc1ccc([N+](=O)[O-])c(C(=O)OC(C)C(=O)Nc2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H13Cl3N2O5S/c1-8(16(23)21-14-7-12(19)11(18)6-13(14)20)27-17(24)10-5-9(28-2)3-4-15(10)22(25)26/h3-8H,1-2H3,(H,21,23) |
| InChIKey | WNPFJSOJJLBPQV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.73 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|