C20H26N4OS — CID 55463918
1-[(2,6-dimethylquinoline-3-carbonyl)amino]-3-(2-methylcyclohexyl)thiourea (PubChem CID 55463918) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is 1-[(2,6-dimethylquinoline-3-carbonyl)amino]-3-(2-methylcyclohexyl)thiourea.
| Compound Name | 1-[(2,6-dimethylquinoline-3-carbonyl)amino]-3-(2-methylcyclohexyl)thiourea |
|---|---|
| PubChem CID | 55463918 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-[(2,6-dimethylquinoline-3-carbonyl)amino]-3-(2-methylcyclohexyl)thiourea |
| SMILES | Cc1ccc2nc(C)c(C(=O)NNC(=S)NC3CCCCC3C)cc2c1 |
| InChI | InChI=1S/C20H26N4OS/c1-12-8-9-18-15(10-12)11-16(14(3)21-18)19(25)23-24-20(26)22-17-7-5-4-6-13(17)2/h8-11,13,17H,4-7H2,1-3H3,(H,23,25)(H2,22,24,26) |
| InChIKey | CQCVJDJTXKRESL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|