C22H22ClN3O6 — CID 55465206
[2-[5-chloro-2-(4-methylphenoxy)anilino]-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 55465206) has the molecular formula C22H22ClN3O6 and a molecular weight of 459.89 g/mol. Its IUPAC name is [2-[5-chloro-2-(4-methylphenoxy)anilino]-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [2-[5-chloro-2-(4-methylphenoxy)anilino]-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 55465206 |
| Molecular Formula | C22H22ClN3O6 |
| Molecular Weight | 459.89 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | [2-[5-chloro-2-(4-methylphenoxy)anilino]-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | Cc1ccc(Oc2ccc(Cl)cc2NC(=O)COC(=O)CN2C(=O)NC(C)(C)C2=O)cc1 |
| InChI | InChI=1S/C22H22ClN3O6/c1-13-4-7-15(8-5-13)32-17-9-6-14(23)10-16(17)24-18(27)12-31-19(28)11-26-20(29)22(2,3)25-21(26)30/h4-10H,11-12H2,1-3H3,(H,24,27)(H,25,30) |
| InChIKey | USRMBBLVTNABRJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.89 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|