C20H11ClF3N5O3S — CID 55465807
1-(3-chlorophenyl)-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 55465807) has the molecular formula C20H11ClF3N5O3S and a molecular weight of 493.85 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55465807 |
| Molecular Formula | C20H11ClF3N5O3S |
| Molecular Weight | 493.85 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | O=C(Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1)c1cnn(-c2cccc(Cl)c2)c1C(F)(F)F |
| InChI | InChI=1S/C20H11ClF3N5O3S/c21-12-4-2-5-13(8-12)28-17(20(22,23)24)15(9-25-28)18(30)27-19-26-16(10-33-19)11-3-1-6-14(7-11)29(31)32/h1-10H,(H,26,27,30) |
| InChIKey | ARJLFFPRDOLHQZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.85 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|