C25H24N2O7 — CID 55468829
[2-oxo-2-[4-(phenylcarbamoyl)piperidin-1-yl]ethyl] 2-(2-oxochromen-7-yl)oxyacetate (PubChem CID 55468829) has the molecular formula C25H24N2O7 and a molecular weight of 464.47 g/mol. Its IUPAC name is [2-oxo-2-[4-(phenylcarbamoyl)piperidin-1-yl]ethyl] 2-(2-oxochromen-7-yl)oxyacetate.
| Compound Name | [2-oxo-2-[4-(phenylcarbamoyl)piperidin-1-yl]ethyl] 2-(2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 55468829 |
| Molecular Formula | C25H24N2O7 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | [2-oxo-2-[4-(phenylcarbamoyl)piperidin-1-yl]ethyl] 2-(2-oxochromen-7-yl)oxyacetate |
| SMILES | O=C(COc1ccc2ccc(=O)oc2c1)OCC(=O)N1CCC(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C25H24N2O7/c28-22(27-12-10-18(11-13-27)25(31)26-19-4-2-1-3-5-19)15-33-24(30)16-32-20-8-6-17-7-9-23(29)34-21(17)14-20/h1-9,14,18H,10-13,15-16H2,(H,26,31) |
| InChIKey | SLAAOFNNDVFOIE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|