C14H17F2N3O5S — CID 55471148
2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-1-(4-methylsulfonylpiperazin-1-yl)ethanone (PubChem CID 55471148) has the molecular formula C14H17F2N3O5S and a molecular weight of 377.37 g/mol. Its IUPAC name is 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-1-(4-methylsulfonylpiperazin-1-yl)ethanone.
| Compound Name | 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-1-(4-methylsulfonylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 55471148 |
| Molecular Formula | C14H17F2N3O5S |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-1-(4-methylsulfonylpiperazin-1-yl)ethanone |
| SMILES | CS(=O)(=O)N1CCN(C(=O)CNc2ccc3c(c2)OC(F)(F)O3)CC1 |
| InChI | InChI=1S/C14H17F2N3O5S/c1-25(21,22)19-6-4-18(5-7-19)13(20)9-17-10-2-3-11-12(8-10)24-14(15,16)23-11/h2-3,8,17H,4-7,9H2,1H3 |
| InChIKey | HZTPZFSHVDZHRZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|