C17H24N2O4S — CID 55472520
3-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-5-methyloxolan-2-one (PubChem CID 55472520) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is 3-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-5-methyloxolan-2-one.
| Compound Name | 3-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 55472520 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 3-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-5-methyloxolan-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C3CC(C)OC3=O)CC2)c(C)c1 |
| InChI | InChI=1S/C17H24N2O4S/c1-12-4-5-16(13(2)10-12)24(21,22)19-8-6-18(7-9-19)15-11-14(3)23-17(15)20/h4-5,10,14-15H,6-9,11H2,1-3H3 |
| InChIKey | DFUHTSAYBOQYMM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |