C18H20Cl3N3O3S2 — CID 55478057
2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 55478057) has the molecular formula C18H20Cl3N3O3S2 and a molecular weight of 496.87 g/mol. Its IUPAC name is 2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | 2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 55478057 |
| Molecular Formula | C18H20Cl3N3O3S2 |
| Molecular Weight | 496.87 g/mol |
| Exact Mass | 495.00 |
| IUPAC Name | 2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | CC(C(=O)Nc1cc(Cl)c(Cl)cc1Cl)N1CCC(NS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C18H20Cl3N3O3S2/c1-11(18(25)22-16-10-14(20)13(19)9-15(16)21)24-6-4-12(5-7-24)23-29(26,27)17-3-2-8-28-17/h2-3,8-12,23H,4-7H2,1H3,(H,22,25) |
| InChIKey | GQWNSEYMWSAPSX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.87 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|