C22H28N6O4S — CID 55503001
4-[3-(1H-benzimidazol-2-yl)piperidin-1-yl]-N-[2-(dimethylamino)ethyl]-3-nitrobenzenesulfonamide (PubChem CID 55503001) has the molecular formula C22H28N6O4S and a molecular weight of 472.57 g/mol. Its IUPAC name is 4-[3-(1H-benzimidazol-2-yl)piperidin-1-yl]-N-[2-(dimethylamino)ethyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[3-(1H-benzimidazol-2-yl)piperidin-1-yl]-N-[2-(dimethylamino)ethyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55503001 |
| Molecular Formula | C22H28N6O4S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 4-[3-(1H-benzimidazol-2-yl)piperidin-1-yl]-N-[2-(dimethylamino)ethyl]-3-nitrobenzenesulfonamide |
| SMILES | CN(C)CCNS(=O)(=O)c1ccc(N2CCCC(c3nc4ccccc4[nH]3)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H28N6O4S/c1-26(2)13-11-23-33(31,32)17-9-10-20(21(14-17)28(29)30)27-12-5-6-16(15-27)22-24-18-7-3-4-8-19(18)25-22/h3-4,7-10,14,16,23H,5-6,11-13,15H2,1-2H3,(H,24,25) |
| InChIKey | AGESACXBHKRSIP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 124.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|