C20H32N6O6S — CID 46817481
N-[2-(dimethylamino)ethyl]-4-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]-3-nitrobenzenesulfonamide (PubChem CID 46817481) has the molecular formula C20H32N6O6S and a molecular weight of 484.58 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 46817481 |
| Molecular Formula | C20H32N6O6S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]-3-nitrobenzenesulfonamide |
| SMILES | CN(C)CCNS(=O)(=O)c1ccc(N2CCN(CC(=O)N3CCOCC3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H32N6O6S/c1-22(2)6-5-21-33(30,31)17-3-4-18(19(15-17)26(28)29)24-9-7-23(8-10-24)16-20(27)25-11-13-32-14-12-25/h3-4,15,21H,5-14,16H2,1-2H3 |
| InChIKey | PALMADDZEGLUMZ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 128.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|