C19H25N3O4 — CID 55503576
[2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-(3-methyl-2-oxobenzimidazol-1-yl)acetate (PubChem CID 55503576) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-(3-methyl-2-oxobenzimidazol-1-yl)acetate.
| Compound Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-(3-methyl-2-oxobenzimidazol-1-yl)acetate |
|---|---|
| PubChem CID | 55503576 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-(3-methyl-2-oxobenzimidazol-1-yl)acetate |
| SMILES | CC1CCC(NC(=O)COC(=O)Cn2c(=O)n(C)c3ccccc32)CC1 |
| InChI | InChI=1S/C19H25N3O4/c1-13-7-9-14(10-8-13)20-17(23)12-26-18(24)11-22-16-6-4-3-5-15(16)21(2)19(22)25/h3-6,13-14H,7-12H2,1-2H3,(H,20,23) |
| InChIKey | FGZQDEYEFFESNS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |