C17H21F2N3O4S — CID 55507255
1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 1-methylsulfonylpiperidine-4-carboxylate (PubChem CID 55507255) has the molecular formula C17H21F2N3O4S and a molecular weight of 401.44 g/mol. Its IUPAC name is 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 1-methylsulfonylpiperidine-4-carboxylate.
| Compound Name | 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 1-methylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 55507255 |
| Molecular Formula | C17H21F2N3O4S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 1-methylsulfonylpiperidine-4-carboxylate |
| SMILES | CC(OC(=O)C1CCN(S(C)(=O)=O)CC1)c1nc2ccccc2n1C(F)F |
| InChI | InChI=1S/C17H21F2N3O4S/c1-11(15-20-13-5-3-4-6-14(13)22(15)17(18)19)26-16(23)12-7-9-21(10-8-12)27(2,24)25/h3-6,11-12,17H,7-10H2,1-2H3 |
| InChIKey | FMNZKPAEIGISPK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |