C22H25N3O2S2 — CID 55508857
N-[3-(1-cyclopropylimidazol-2-yl)sulfanyl-1-phenylpropyl]-4-methylbenzenesulfonamide (PubChem CID 55508857) has the molecular formula C22H25N3O2S2 and a molecular weight of 427.60 g/mol. Its IUPAC name is N-[3-(1-cyclopropylimidazol-2-yl)sulfanyl-1-phenylpropyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-(1-cyclopropylimidazol-2-yl)sulfanyl-1-phenylpropyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 55508857 |
| Molecular Formula | C22H25N3O2S2 |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | N-[3-(1-cyclopropylimidazol-2-yl)sulfanyl-1-phenylpropyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CCSc2nccn2C2CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H25N3O2S2/c1-17-7-11-20(12-8-17)29(26,27)24-21(18-5-3-2-4-6-18)13-16-28-22-23-14-15-25(22)19-9-10-19/h2-8,11-12,14-15,19,21,24H,9-10,13,16H2,1H3 |
| InChIKey | MLVXXRBSGAPJEC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |