C21H24N2O5S3 — CID 55527747
N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-5-(dithiolan-3-yl)pentanamide (PubChem CID 55527747) has the molecular formula C21H24N2O5S3 and a molecular weight of 480.63 g/mol. Its IUPAC name is N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-5-(dithiolan-3-yl)pentanamide.
| Compound Name | N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-5-(dithiolan-3-yl)pentanamide |
|---|---|
| PubChem CID | 55527747 |
| Molecular Formula | C21H24N2O5S3 |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | N-[2-[(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-5-(dithiolan-3-yl)pentanamide |
| SMILES | O=C(CCCCC1CCSS1)NCCN1C(=O)S/C(=C\c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C21H24N2O5S3/c24-19(4-2-1-3-15-7-10-29-31-15)22-8-9-23-20(25)18(30-21(23)26)12-14-5-6-16-17(11-14)28-13-27-16/h5-6,11-12,15H,1-4,7-10,13H2,(H,22,24)/b18-12- |
| InChIKey | HZLCPMRCORPOLT-PDGQHHTCSA-N |
| XLogP | 4.28 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|