C25H23FN4O3 — CID 55540200
N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-3-(phenoxymethyl)furan-2-carboxamide (PubChem CID 55540200) has the molecular formula C25H23FN4O3 and a molecular weight of 446.48 g/mol. Its IUPAC name is N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-3-(phenoxymethyl)furan-2-carboxamide.
| Compound Name | N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-3-(phenoxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 55540200 |
| Molecular Formula | C25H23FN4O3 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-3-(phenoxymethyl)furan-2-carboxamide |
| SMILES | O=C(Nc1cc(-c2nnc3n2CCCCC3)ccc1F)c1occc1COc1ccccc1 |
| InChI | InChI=1S/C25H23FN4O3/c26-20-11-10-17(24-29-28-22-9-5-2-6-13-30(22)24)15-21(20)27-25(31)23-18(12-14-32-23)16-33-19-7-3-1-4-8-19/h1,3-4,7-8,10-12,14-15H,2,5-6,9,13,16H2,(H,27,31) |
| InChIKey | NUSSRAXHDVKZLB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |