C24H22FN5OS2 — CID 55548772
N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-(1,3-thiazol-4-ylmethylsulfanyl)benzamide (PubChem CID 55548772) has the molecular formula C24H22FN5OS2 and a molecular weight of 479.61 g/mol. Its IUPAC name is N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-(1,3-thiazol-4-ylmethylsulfanyl)benzamide.
| Compound Name | N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-(1,3-thiazol-4-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 55548772 |
| Molecular Formula | C24H22FN5OS2 |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | N-[2-fluoro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]-2-(1,3-thiazol-4-ylmethylsulfanyl)benzamide |
| SMILES | O=C(Nc1cc(-c2nnc3n2CCCCC3)ccc1F)c1ccccc1SCc1cscn1 |
| InChI | InChI=1S/C24H22FN5OS2/c25-19-10-9-16(23-29-28-22-8-2-1-5-11-30(22)23)12-20(19)27-24(31)18-6-3-4-7-21(18)33-14-17-13-32-15-26-17/h3-4,6-7,9-10,12-13,15H,1-2,5,8,11,14H2,(H,27,31) |
| InChIKey | XVGBXXUAMVGHSG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |