C20H22F3N3O4S — CID 55549476
N-tert-butyl-4-[[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetyl]amino]benzamide (PubChem CID 55549476) has the molecular formula C20H22F3N3O4S and a molecular weight of 457.47 g/mol. Its IUPAC name is N-tert-butyl-4-[[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetyl]amino]benzamide.
| Compound Name | N-tert-butyl-4-[[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 55549476 |
| Molecular Formula | C20H22F3N3O4S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | N-tert-butyl-4-[[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetyl]amino]benzamide |
| SMILES | CC(C)(C)NC(=O)c1ccc(NC(=O)CNS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H22F3N3O4S/c1-19(2,3)26-18(28)13-7-9-15(10-8-13)25-17(27)12-24-31(29,30)16-6-4-5-14(11-16)20(21,22)23/h4-11,24H,12H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | NPIDDPMLARMPOG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |