C18H21F3N4O3S — CID 56545982
N-[6-(diethylamino)-3-pyridinyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide (PubChem CID 56545982) has the molecular formula C18H21F3N4O3S and a molecular weight of 430.45 g/mol. Its IUPAC name is N-[6-(diethylamino)-3-pyridinyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide.
| Compound Name | N-[6-(diethylamino)-3-pyridinyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 56545982 |
| Molecular Formula | C18H21F3N4O3S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | N-[6-(diethylamino)-3-pyridinyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CNS(=O)(=O)c2cccc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C18H21F3N4O3S/c1-3-25(4-2)16-9-8-14(11-22-16)24-17(26)12-23-29(27,28)15-7-5-6-13(10-15)18(19,20)21/h5-11,23H,3-4,12H2,1-2H3,(H,24,26) |
| InChIKey | SKTWBUDUEIBKMV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |