C14H13Cl3N2O4 — CID 55562882
(3-propyl-1,2,4-oxadiazol-5-yl)methyl 2-(2,4,5-trichlorophenoxy)acetate (PubChem CID 55562882) has the molecular formula C14H13Cl3N2O4 and a molecular weight of 379.63 g/mol. Its IUPAC name is (3-propyl-1,2,4-oxadiazol-5-yl)methyl 2-(2,4,5-trichlorophenoxy)acetate.
| Compound Name | (3-propyl-1,2,4-oxadiazol-5-yl)methyl 2-(2,4,5-trichlorophenoxy)acetate |
|---|---|
| PubChem CID | 55562882 |
| Molecular Formula | C14H13Cl3N2O4 |
| Molecular Weight | 379.63 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | (3-propyl-1,2,4-oxadiazol-5-yl)methyl 2-(2,4,5-trichlorophenoxy)acetate |
| SMILES | CCCc1noc(COC(=O)COc2cc(Cl)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C14H13Cl3N2O4/c1-2-3-12-18-13(23-19-12)6-22-14(20)7-21-11-5-9(16)8(15)4-10(11)17/h4-5H,2-3,6-7H2,1H3 |
| InChIKey | KIFXKUYMUKSWMV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.63 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|