C21H24ClN5O5 — CID 55578882
ethyl 6-[4-[1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl]piperazin-1-yl]pyridine-3-carboxylate (PubChem CID 55578882) has the molecular formula C21H24ClN5O5 and a molecular weight of 461.91 g/mol. Its IUPAC name is ethyl 6-[4-[1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl]piperazin-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[4-[1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl]piperazin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 55578882 |
| Molecular Formula | C21H24ClN5O5 |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | ethyl 6-[4-[1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl]piperazin-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2CCN(C(C)C(=O)Nc3cc([N+](=O)[O-])ccc3Cl)CC2)nc1 |
| InChI | InChI=1S/C21H24ClN5O5/c1-3-32-21(29)15-4-7-19(23-13-15)26-10-8-25(9-11-26)14(2)20(28)24-18-12-16(27(30)31)5-6-17(18)22/h4-7,12-14H,3,8-11H2,1-2H3,(H,24,28) |
| InChIKey | CBRNXEFBILEKEW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 117.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|