C19H28N4O4 — CID 55940492
ethyl 6-[4-[2-(2-methylbutanoylamino)acetyl]piperazin-1-yl]pyridine-3-carboxylate (PubChem CID 55940492) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is ethyl 6-[4-[2-(2-methylbutanoylamino)acetyl]piperazin-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[4-[2-(2-methylbutanoylamino)acetyl]piperazin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 55940492 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | ethyl 6-[4-[2-(2-methylbutanoylamino)acetyl]piperazin-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2CCN(C(=O)CNC(=O)C(C)CC)CC2)nc1 |
| InChI | InChI=1S/C19H28N4O4/c1-4-14(3)18(25)21-13-17(24)23-10-8-22(9-11-23)16-7-6-15(12-20-16)19(26)27-5-2/h6-7,12,14H,4-5,8-11,13H2,1-3H3,(H,21,25) |
| InChIKey | RDRHQZUUFVTYJA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |