C26H18Cl2N4O3 — CID 555953
N-[2-(2,4-dichlorophenyl)imidazo[1,2-a]pyridin-3-yl]-1-[5-(2,5-dimethyl-3-nitrophenyl)furan-2-yl]methanimine (PubChem CID 555953) has the molecular formula C26H18Cl2N4O3 and a molecular weight of 505.36 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)imidazo[1,2-a]pyridin-3-yl]-1-[5-(2,5-dimethyl-3-nitrophenyl)furan-2-yl]methanimine.
| Compound Name | N-[2-(2,4-dichlorophenyl)imidazo[1,2-a]pyridin-3-yl]-1-[5-(2,5-dimethyl-3-nitrophenyl)furan-2-yl]methanimine |
|---|---|
| PubChem CID | 555953 |
| Molecular Formula | C26H18Cl2N4O3 |
| Molecular Weight | 505.36 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)imidazo[1,2-a]pyridin-3-yl]-1-[5-(2,5-dimethyl-3-nitrophenyl)furan-2-yl]methanimine |
| SMILES | Cc1cc(-c2ccc(C=Nc3c(-c4ccc(Cl)cc4Cl)nc4ccccn34)o2)c(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H18Cl2N4O3/c1-15-11-20(16(2)22(12-15)32(33)34)23-9-7-18(35-23)14-29-26-25(19-8-6-17(27)13-21(19)28)30-24-5-3-4-10-31(24)26/h3-14H,1-2H3 |
| InChIKey | ZGCIOJTYNSNKTA-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 85.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.36 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|