C23H34FN3O3S — CID 55599943
N-cyclohexyl-4-[1-(3-fluorophenyl)cyclopentanecarbonyl]-N-methylpiperazine-1-sulfonamide (PubChem CID 55599943) has the molecular formula C23H34FN3O3S and a molecular weight of 451.61 g/mol. Its IUPAC name is N-cyclohexyl-4-[1-(3-fluorophenyl)cyclopentanecarbonyl]-N-methylpiperazine-1-sulfonamide.
| Compound Name | N-cyclohexyl-4-[1-(3-fluorophenyl)cyclopentanecarbonyl]-N-methylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 55599943 |
| Molecular Formula | C23H34FN3O3S |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | N-cyclohexyl-4-[1-(3-fluorophenyl)cyclopentanecarbonyl]-N-methylpiperazine-1-sulfonamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)N1CCN(C(=O)C2(c3cccc(F)c3)CCCC2)CC1 |
| InChI | InChI=1S/C23H34FN3O3S/c1-25(21-10-3-2-4-11-21)31(29,30)27-16-14-26(15-17-27)22(28)23(12-5-6-13-23)19-8-7-9-20(24)18-19/h7-9,18,21H,2-6,10-17H2,1H3 |
| InChIKey | MXKHQJCKAPNAEG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |