C23H26N4O4 — CID 55615324
2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-(2-methyl-4-morpholin-4-ylphenyl)acetamide (PubChem CID 55615324) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-(2-methyl-4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-(2-methyl-4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 55615324 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)-N-(2-methyl-4-morpholin-4-ylphenyl)acetamide |
| SMILES | CCn1c(=O)c2ccccc2n(CC(=O)Nc2ccc(N3CCOCC3)cc2C)c1=O |
| InChI | InChI=1S/C23H26N4O4/c1-3-26-22(29)18-6-4-5-7-20(18)27(23(26)30)15-21(28)24-19-9-8-17(14-16(19)2)25-10-12-31-13-11-25/h4-9,14H,3,10-13,15H2,1-2H3,(H,24,28) |
| InChIKey | CERLZPXZHQSHSU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|