C23H30N4O5S — CID 55627077
1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(2-nitro-4-piperidin-1-ylsulfonylanilino)propan-2-ol (PubChem CID 55627077) has the molecular formula C23H30N4O5S and a molecular weight of 474.58 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(2-nitro-4-piperidin-1-ylsulfonylanilino)propan-2-ol.
| Compound Name | 1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(2-nitro-4-piperidin-1-ylsulfonylanilino)propan-2-ol |
|---|---|
| PubChem CID | 55627077 |
| Molecular Formula | C23H30N4O5S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(2-nitro-4-piperidin-1-ylsulfonylanilino)propan-2-ol |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCCC2)ccc1NCC(O)CN1CCc2ccccc2C1 |
| InChI | InChI=1S/C23H30N4O5S/c28-20(17-25-13-10-18-6-2-3-7-19(18)16-25)15-24-22-9-8-21(14-23(22)27(29)30)33(31,32)26-11-4-1-5-12-26/h2-3,6-9,14,20,24,28H,1,4-5,10-13,15-17H2 |
| InChIKey | RQTSFHGEHVXBNG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 116.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|