C18H30N6O3S — CID 55642231
2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]acetamide (PubChem CID 55642231) has the molecular formula C18H30N6O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]acetamide.
| Compound Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 55642231 |
| Molecular Formula | C18H30N6O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]acetamide |
| SMILES | O=C(CSc1nnnn1C1CCCC1)NCC(C1CCOC1)N1CCOCC1 |
| InChI | InChI=1S/C18H30N6O3S/c25-17(13-28-18-20-21-22-24(18)15-3-1-2-4-15)19-11-16(14-5-8-27-12-14)23-6-9-26-10-7-23/h14-16H,1-13H2,(H,19,25) |
| InChIKey | SGAGVJIXCDPNEC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |