C16H21BrN4O3S2 — CID 55655780
1-(5-bromothiophen-2-yl)sulfonyl-N-(2-propylpyrazol-3-yl)piperidine-4-carboxamide (PubChem CID 55655780) has the molecular formula C16H21BrN4O3S2 and a molecular weight of 461.41 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-N-(2-propylpyrazol-3-yl)piperidine-4-carboxamide.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(2-propylpyrazol-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55655780 |
| Molecular Formula | C16H21BrN4O3S2 |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(2-propylpyrazol-3-yl)piperidine-4-carboxamide |
| SMILES | CCCn1nccc1NC(=O)C1CCN(S(=O)(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C16H21BrN4O3S2/c1-2-9-21-14(5-8-18-21)19-16(22)12-6-10-20(11-7-12)26(23,24)15-4-3-13(17)25-15/h3-5,8,12H,2,6-7,9-11H2,1H3,(H,19,22) |
| InChIKey | VMFXJOZYLMNIPY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |