C19H17F3N6O4S — CID 55681236
1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-4-(2,3,4-trifluorophenyl)sulfonylpiperazine (PubChem CID 55681236) has the molecular formula C19H17F3N6O4S and a molecular weight of 482.44 g/mol. Its IUPAC name is 1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-4-(2,3,4-trifluorophenyl)sulfonylpiperazine.
| Compound Name | 1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-4-(2,3,4-trifluorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 55681236 |
| Molecular Formula | C19H17F3N6O4S |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-4-(2,3,4-trifluorophenyl)sulfonylpiperazine |
| SMILES | O=[N+]([O-])c1ccc(-c2ncn(CN3CCN(S(=O)(=O)c4ccc(F)c(F)c4F)CC3)n2)cc1 |
| InChI | InChI=1S/C19H17F3N6O4S/c20-15-5-6-16(18(22)17(15)21)33(31,32)27-9-7-25(8-10-27)12-26-11-23-19(24-26)13-1-3-14(4-2-13)28(29)30/h1-6,11H,7-10,12H2 |
| InChIKey | WMQBSFZSPPPURU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 114.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|