C19H18Cl2N6O4S — CID 60524272
1-(2,3-dichlorophenyl)sulfonyl-4-[[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]methyl]piperazine (PubChem CID 60524272) has the molecular formula C19H18Cl2N6O4S and a molecular weight of 497.36 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)sulfonyl-4-[[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]methyl]piperazine.
| Compound Name | 1-(2,3-dichlorophenyl)sulfonyl-4-[[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]methyl]piperazine |
|---|---|
| PubChem CID | 60524272 |
| Molecular Formula | C19H18Cl2N6O4S |
| Molecular Weight | 497.36 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | 1-(2,3-dichlorophenyl)sulfonyl-4-[[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]methyl]piperazine |
| SMILES | O=[N+]([O-])c1cccc(-c2ncn(CN3CCN(S(=O)(=O)c4cccc(Cl)c4Cl)CC3)n2)c1 |
| InChI | InChI=1S/C19H18Cl2N6O4S/c20-16-5-2-6-17(18(16)21)32(30,31)26-9-7-24(8-10-26)13-25-12-22-19(23-25)14-3-1-4-15(11-14)27(28)29/h1-6,11-12H,7-10,13H2 |
| InChIKey | MGAFMZIBLYJFKS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 114.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|