C18H14ClN3O4 — CID 55683983
N'-(5-chloro-2-hydroxybenzoyl)-3-(4-methylphenyl)-1,2-oxazole-5-carbohydrazide (PubChem CID 55683983) has the molecular formula C18H14ClN3O4 and a molecular weight of 371.78 g/mol. Its IUPAC name is N'-(5-chloro-2-hydroxybenzoyl)-3-(4-methylphenyl)-1,2-oxazole-5-carbohydrazide.
| Compound Name | N'-(5-chloro-2-hydroxybenzoyl)-3-(4-methylphenyl)-1,2-oxazole-5-carbohydrazide |
|---|---|
| PubChem CID | 55683983 |
| Molecular Formula | C18H14ClN3O4 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N'-(5-chloro-2-hydroxybenzoyl)-3-(4-methylphenyl)-1,2-oxazole-5-carbohydrazide |
| SMILES | Cc1ccc(-c2cc(C(=O)NNC(=O)c3cc(Cl)ccc3O)on2)cc1 |
| InChI | InChI=1S/C18H14ClN3O4/c1-10-2-4-11(5-3-10)14-9-16(26-22-14)18(25)21-20-17(24)13-8-12(19)6-7-15(13)23/h2-9,23H,1H3,(H,20,24)(H,21,25) |
| InChIKey | LLEGSEMUOVPYQV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|