C23H26F2N4O4 — CID 55701062
1-[5-[[(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoyl]amino]-2-pyridinyl]piperidine-3-carboxamide (PubChem CID 55701062) has the molecular formula C23H26F2N4O4 and a molecular weight of 460.48 g/mol. Its IUPAC name is 1-[5-[[(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoyl]amino]-2-pyridinyl]piperidine-3-carboxamide.
| Compound Name | 1-[5-[[(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoyl]amino]-2-pyridinyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55701062 |
| Molecular Formula | C23H26F2N4O4 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 1-[5-[[(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoyl]amino]-2-pyridinyl]piperidine-3-carboxamide |
| SMILES | CCOc1cc(/C=C/C(=O)Nc2ccc(N3CCCC(C(N)=O)C3)nc2)ccc1OC(F)F |
| InChI | InChI=1S/C23H26F2N4O4/c1-2-32-19-12-15(5-8-18(19)33-23(24)25)6-10-21(30)28-17-7-9-20(27-13-17)29-11-3-4-16(14-29)22(26)31/h5-10,12-13,16,23H,2-4,11,14H2,1H3,(H2,26,31)(H,28,30)/b10-6+ |
| InChIKey | VEFWJMIPTZFOEM-UXBLZVDNSA-N |
| XLogP | 3.44 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|