C24H16ClF2N3O4 — CID 55726166
N-[3-[3-chloro-4-(1,3-dioxoisoindol-2-yl)anilino]-3-oxopropyl]-2,4-difluorobenzamide (PubChem CID 55726166) has the molecular formula C24H16ClF2N3O4 and a molecular weight of 483.86 g/mol. Its IUPAC name is N-[3-[3-chloro-4-(1,3-dioxoisoindol-2-yl)anilino]-3-oxopropyl]-2,4-difluorobenzamide.
| Compound Name | N-[3-[3-chloro-4-(1,3-dioxoisoindol-2-yl)anilino]-3-oxopropyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 55726166 |
| Molecular Formula | C24H16ClF2N3O4 |
| Molecular Weight | 483.86 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | N-[3-[3-chloro-4-(1,3-dioxoisoindol-2-yl)anilino]-3-oxopropyl]-2,4-difluorobenzamide |
| SMILES | O=C(CCNC(=O)c1ccc(F)cc1F)Nc1ccc(N2C(=O)c3ccccc3C2=O)c(Cl)c1 |
| InChI | InChI=1S/C24H16ClF2N3O4/c25-18-12-14(6-8-20(18)30-23(33)15-3-1-2-4-16(15)24(30)34)29-21(31)9-10-28-22(32)17-7-5-13(26)11-19(17)27/h1-8,11-12H,9-10H2,(H,28,32)(H,29,31) |
| InChIKey | XFNDTSYXCVSSGG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.86 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|