C22H24ClN3O6 — CID 55734778
[2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 6-acetamidohexanoate (PubChem CID 55734778) has the molecular formula C22H24ClN3O6 and a molecular weight of 461.90 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 6-acetamidohexanoate.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 6-acetamidohexanoate |
|---|---|
| PubChem CID | 55734778 |
| Molecular Formula | C22H24ClN3O6 |
| Molecular Weight | 461.90 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 6-acetamidohexanoate |
| SMILES | CC(=O)NCCCCCC(=O)OC(C(=O)Nc1ccc([N+](=O)[O-])cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C22H24ClN3O6/c1-15(27)24-13-7-3-6-10-20(28)32-21(16-8-4-2-5-9-16)22(29)25-19-12-11-17(26(30)31)14-18(19)23/h2,4-5,8-9,11-12,14,21H,3,6-7,10,13H2,1H3,(H,24,27)(H,25,29) |
| InChIKey | YFRZRVPKEIHPHH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.90 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|