C19H26N4O2S — CID 55735880
N-methyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]-N-[(4-piperidin-1-ylphenyl)methyl]acetamide (PubChem CID 55735880) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is N-methyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]-N-[(4-piperidin-1-ylphenyl)methyl]acetamide.
| Compound Name | N-methyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]-N-[(4-piperidin-1-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 55735880 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N-methyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]-N-[(4-piperidin-1-ylphenyl)methyl]acetamide |
| SMILES | Cc1nc(CSCC(=O)N(C)Cc2ccc(N3CCCCC3)cc2)no1 |
| InChI | InChI=1S/C19H26N4O2S/c1-15-20-18(21-25-15)13-26-14-19(24)22(2)12-16-6-8-17(9-7-16)23-10-4-3-5-11-23/h6-9H,3-5,10-14H2,1-2H3 |
| InChIKey | WXPRKPKZOLGEII-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|