C23H22F3N5O3 — CID 55750212
N'-(2-cyclopropyl-1,3-benzoxazol-5-yl)-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]oxamide (PubChem CID 55750212) has the molecular formula C23H22F3N5O3 and a molecular weight of 473.46 g/mol. Its IUPAC name is N'-(2-cyclopropyl-1,3-benzoxazol-5-yl)-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]oxamide.
| Compound Name | N'-(2-cyclopropyl-1,3-benzoxazol-5-yl)-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]oxamide |
|---|---|
| PubChem CID | 55750212 |
| Molecular Formula | C23H22F3N5O3 |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | N'-(2-cyclopropyl-1,3-benzoxazol-5-yl)-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]oxamide |
| SMILES | O=C(Nc1ccc2oc(C3CC3)nc2c1)C(=O)NC1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C23H22F3N5O3/c24-23(25,26)14-3-6-19(27-12-14)31-9-7-15(8-10-31)28-20(32)21(33)29-16-4-5-18-17(11-16)30-22(34-18)13-1-2-13/h3-6,11-13,15H,1-2,7-10H2,(H,28,32)(H,29,33) |
| InChIKey | LQGLLWHDOSWQCH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|